C24H31N3O5S — CID 175127060
1-acetyl-4-[3-[(4-methoxycarbonylphenyl)methyl-sulfinoamino]-1-phenylpropyl]piperazine (PubChem CID 175127060) has the molecular formula C24H31N3O5S and a molecular weight of 473.60 g/mol. Its IUPAC name is 1-acetyl-4-[3-[(4-methoxycarbonylphenyl)methyl-sulfinoamino]-1-phenylpropyl]piperazine.
| Compound Name | 1-acetyl-4-[3-[(4-methoxycarbonylphenyl)methyl-sulfinoamino]-1-phenylpropyl]piperazine |
|---|---|
| PubChem CID | 175127060 |
| Molecular Formula | C24H31N3O5S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 1-acetyl-4-[3-[(4-methoxycarbonylphenyl)methyl-sulfinoamino]-1-phenylpropyl]piperazine |
| SMILES | COC(=O)c1ccc(CN(CCC(c2ccccc2)N2CCN(C(C)=O)CC2)S(=O)O)cc1 |
| InChI | InChI=1S/C24H31N3O5S/c1-19(28)25-14-16-26(17-15-25)23(21-6-4-3-5-7-21)12-13-27(33(30)31)18-20-8-10-22(11-9-20)24(29)32-2/h3-11,23H,12-18H2,1-2H3,(H,30,31) |
| InChIKey | UPUXSNAIHRBUMV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|