C20H24N2O4S — CID 159868704
methyl 4-[(N-piperidin-1-ylsulfonylanilino)methyl]benzoate (PubChem CID 159868704) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is methyl 4-[(N-piperidin-1-ylsulfonylanilino)methyl]benzoate.
| Compound Name | methyl 4-[(N-piperidin-1-ylsulfonylanilino)methyl]benzoate |
|---|---|
| PubChem CID | 159868704 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | methyl 4-[(N-piperidin-1-ylsulfonylanilino)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(c2ccccc2)S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H24N2O4S/c1-26-20(23)18-12-10-17(11-13-18)16-22(19-8-4-2-5-9-19)27(24,25)21-14-6-3-7-15-21/h2,4-5,8-13H,3,6-7,14-16H2,1H3 |
| InChIKey | HLOBGLDHNVCDKP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |