C20H23ClFN3O4S — CID 126545884
methyl 4-[(3-chloro-4-fluoro-N-(4-methylpiperazin-1-yl)sulfonylanilino)methyl]benzoate (PubChem CID 126545884) has the molecular formula C20H23ClFN3O4S and a molecular weight of 455.94 g/mol. Its IUPAC name is methyl 4-[(3-chloro-4-fluoro-N-(4-methylpiperazin-1-yl)sulfonylanilino)methyl]benzoate.
| Compound Name | methyl 4-[(3-chloro-4-fluoro-N-(4-methylpiperazin-1-yl)sulfonylanilino)methyl]benzoate |
|---|---|
| PubChem CID | 126545884 |
| Molecular Formula | C20H23ClFN3O4S |
| Molecular Weight | 455.94 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | methyl 4-[(3-chloro-4-fluoro-N-(4-methylpiperazin-1-yl)sulfonylanilino)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(c2ccc(F)c(Cl)c2)S(=O)(=O)N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C20H23ClFN3O4S/c1-23-9-11-24(12-10-23)30(27,28)25(17-7-8-19(22)18(21)13-17)14-15-3-5-16(6-4-15)20(26)29-2/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | LYAOQAUKWWQZDM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.94 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |