C17H19ClFN5O5S2 — CID 126508848
N-(3-chloro-4-fluorophenyl)-N-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl]-1,1-dioxo-1,4-thiazinane-4-sulfonamide (PubChem CID 126508848) has the molecular formula C17H19ClFN5O5S2 and a molecular weight of 491.95 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-N-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl]-1,1-dioxo-1,4-thiazinane-4-sulfonamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-N-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl]-1,1-dioxo-1,4-thiazinane-4-sulfonamide |
|---|---|
| PubChem CID | 126508848 |
| Molecular Formula | C17H19ClFN5O5S2 |
| Molecular Weight | 491.95 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-N-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl]-1,1-dioxo-1,4-thiazinane-4-sulfonamide |
| SMILES | NNC(=O)c1ccc(CN(c2ccc(F)c(Cl)c2)S(=O)(=O)N2CCS(=O)(=O)CC2)nc1 |
| InChI | InChI=1S/C17H19ClFN5O5S2/c18-15-9-14(3-4-16(15)19)24(11-13-2-1-12(10-21-13)17(25)22-20)31(28,29)23-5-7-30(26,27)8-6-23/h1-4,9-10H,5-8,11,20H2,(H,22,25) |
| InChIKey | FIPORMSJLVMZAQ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 142.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.95 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|