C22H30N6O4S — CID 126508745
(3R)-N-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl]-3-methyl-N-(3-methylphenyl)-4-(oxetan-3-yl)piperazine-1-sulfonamide (PubChem CID 126508745) has the molecular formula C22H30N6O4S and a molecular weight of 474.59 g/mol. Its IUPAC name is (3R)-N-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl]-3-methyl-N-(3-methylphenyl)-4-(oxetan-3-yl)piperazine-1-sulfonamide.
| Compound Name | (3R)-N-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl]-3-methyl-N-(3-methylphenyl)-4-(oxetan-3-yl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 126508745 |
| Molecular Formula | C22H30N6O4S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | (3R)-N-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl]-3-methyl-N-(3-methylphenyl)-4-(oxetan-3-yl)piperazine-1-sulfonamide |
| SMILES | Cc1cccc(N(Cc2ccc(C(=O)NN)cn2)S(=O)(=O)N2CCN(C3COC3)[C@H](C)C2)c1 |
| InChI | InChI=1S/C22H30N6O4S/c1-16-4-3-5-20(10-16)28(13-19-7-6-18(11-24-19)22(29)25-23)33(30,31)26-8-9-27(17(2)12-26)21-14-32-15-21/h3-7,10-11,17,21H,8-9,12-15,23H2,1-2H3,(H,25,29)/t17-/m1/s1 |
| InChIKey | WRWGULNQDAXMTR-QGZVFWFLSA-N |
| XLogP | 0.65 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|