C24H33N5O5S — CID 126506125
tert-butyl 4-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl-(3-methylphenyl)sulfamoyl]piperidine-1-carboxylate (PubChem CID 126506125) has the molecular formula C24H33N5O5S and a molecular weight of 503.63 g/mol. Its IUPAC name is tert-butyl 4-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl-(3-methylphenyl)sulfamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl-(3-methylphenyl)sulfamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 126506125 |
| Molecular Formula | C24H33N5O5S |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | tert-butyl 4-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl-(3-methylphenyl)sulfamoyl]piperidine-1-carboxylate |
| SMILES | Cc1cccc(N(Cc2ccc(C(=O)NN)cn2)S(=O)(=O)C2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C24H33N5O5S/c1-17-6-5-7-20(14-17)29(16-19-9-8-18(15-26-19)22(30)27-25)35(32,33)21-10-12-28(13-11-21)23(31)34-24(2,3)4/h5-9,14-15,21H,10-13,16,25H2,1-4H3,(H,27,30) |
| InChIKey | YCACJMGEXWIJPE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|