C23H30N2O2 — CID 118798320
tert-butyl 4-(N-benzylanilino)piperidine-1-carboxylate (PubChem CID 118798320) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is tert-butyl 4-(N-benzylanilino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(N-benzylanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118798320 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | tert-butyl 4-(N-benzylanilino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N(Cc2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H30N2O2/c1-23(2,3)27-22(26)24-16-14-21(15-17-24)25(20-12-8-5-9-13-20)18-19-10-6-4-7-11-19/h4-13,21H,14-18H2,1-3H3 |
| InChIKey | HULVTHHCVMDEHS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |