C20H33N3O4S — CID 100648914
tert-butyl 4-[[benzyl(ethyl)sulfamoyl]-methylamino]piperidine-1-carboxylate (PubChem CID 100648914) has the molecular formula C20H33N3O4S and a molecular weight of 411.57 g/mol. Its IUPAC name is tert-butyl 4-[[benzyl(ethyl)sulfamoyl]-methylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[benzyl(ethyl)sulfamoyl]-methylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 100648914 |
| Molecular Formula | C20H33N3O4S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | tert-butyl 4-[[benzyl(ethyl)sulfamoyl]-methylamino]piperidine-1-carboxylate |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)N(C)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H33N3O4S/c1-6-23(16-17-10-8-7-9-11-17)28(25,26)21(5)18-12-14-22(15-13-18)19(24)27-20(2,3)4/h7-11,18H,6,12-16H2,1-5H3 |
| InChIKey | HUVZAYCWYKHGIK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |