C25H38N2O2S — CID 87570963
tert-butyl 4-[benzyl-(2-cyclohexylethanethioyl)amino]piperidine-1-carboxylate (PubChem CID 87570963) has the molecular formula C25H38N2O2S and a molecular weight of 430.66 g/mol. Its IUPAC name is tert-butyl 4-[benzyl-(2-cyclohexylethanethioyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[benzyl-(2-cyclohexylethanethioyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87570963 |
| Molecular Formula | C25H38N2O2S |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | tert-butyl 4-[benzyl-(2-cyclohexylethanethioyl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N(Cc2ccccc2)C(=S)CC2CCCCC2)CC1 |
| InChI | InChI=1S/C25H38N2O2S/c1-25(2,3)29-24(28)26-16-14-22(15-17-26)27(19-21-12-8-5-9-13-21)23(30)18-20-10-6-4-7-11-20/h5,8-9,12-13,20,22H,4,6-7,10-11,14-19H2,1-3H3 |
| InChIKey | QNSFPNCZBSLNHC-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|