C29H41N3O2 — CID 68810453
tert-butyl 4-[4-(N-benzylanilino)piperidin-1-yl]-4-methylpiperidine-1-carboxylate (PubChem CID 68810453) has the molecular formula C29H41N3O2 and a molecular weight of 463.67 g/mol. Its IUPAC name is tert-butyl 4-[4-(N-benzylanilino)piperidin-1-yl]-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(N-benzylanilino)piperidin-1-yl]-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 68810453 |
| Molecular Formula | C29H41N3O2 |
| Molecular Weight | 463.67 g/mol |
| Exact Mass | 463.32 |
| IUPAC Name | tert-butyl 4-[4-(N-benzylanilino)piperidin-1-yl]-4-methylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C)(N2CCC(N(Cc3ccccc3)c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C29H41N3O2/c1-28(2,3)34-27(33)30-21-17-29(4,18-22-30)31-19-15-26(16-20-31)32(25-13-9-6-10-14-25)23-24-11-7-5-8-12-24/h5-14,26H,15-23H2,1-4H3 |
| InChIKey | WQDWXRPPBXONCK-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.67 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |