C26H31F3N2O3 — CID 91126915
tert-butyl 4-benzyl-4-[benzyl(trifluoromethyl)carbamoyl]piperidine-1-carboxylate (PubChem CID 91126915) has the molecular formula C26H31F3N2O3 and a molecular weight of 476.54 g/mol. Its IUPAC name is tert-butyl 4-benzyl-4-[benzyl(trifluoromethyl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-benzyl-4-[benzyl(trifluoromethyl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91126915 |
| Molecular Formula | C26H31F3N2O3 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | tert-butyl 4-benzyl-4-[benzyl(trifluoromethyl)carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Cc2ccccc2)(C(=O)N(Cc2ccccc2)C(F)(F)F)CC1 |
| InChI | InChI=1S/C26H31F3N2O3/c1-24(2,3)34-23(33)30-16-14-25(15-17-30,18-20-10-6-4-7-11-20)22(32)31(26(27,28)29)19-21-12-8-5-9-13-21/h4-13H,14-19H2,1-3H3 |
| InChIKey | PHWIQKYVOPUUQR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|