C18H22FNO2 — CID 10685859
tert-butyl 4-fluoro-4-(2-phenylethynyl)piperidine-1-carboxylate (PubChem CID 10685859) has the molecular formula C18H22FNO2 and a molecular weight of 303.38 g/mol. Its IUPAC name is tert-butyl 4-fluoro-4-(2-phenylethynyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-fluoro-4-(2-phenylethynyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10685859 |
| Molecular Formula | C18H22FNO2 |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | tert-butyl 4-fluoro-4-(2-phenylethynyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)(C#Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H22FNO2/c1-17(2,3)22-16(21)20-13-11-18(19,12-14-20)10-9-15-7-5-4-6-8-15/h4-8H,11-14H2,1-3H3 |
| InChIKey | LZQNQALPPLMLCZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|