C30H35FN2O2 — CID 129320067
tert-butyl 4-[3-(dibenzylamino)phenyl]-4-fluoropiperidine-1-carboxylate (PubChem CID 129320067) has the molecular formula C30H35FN2O2 and a molecular weight of 474.62 g/mol. Its IUPAC name is tert-butyl 4-[3-(dibenzylamino)phenyl]-4-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(dibenzylamino)phenyl]-4-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 129320067 |
| Molecular Formula | C30H35FN2O2 |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | tert-butyl 4-[3-(dibenzylamino)phenyl]-4-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)(c2cccc(N(Cc3ccccc3)Cc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C30H35FN2O2/c1-29(2,3)35-28(34)32-19-17-30(31,18-20-32)26-15-10-16-27(21-26)33(22-24-11-6-4-7-12-24)23-25-13-8-5-9-14-25/h4-16,21H,17-20,22-23H2,1-3H3 |
| InChIKey | BSCCDQLDKXLIJI-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |