C29H33F2N3O2 — CID 86725376
tert-butyl 4-[4-(dibenzylamino)-2,5-difluorophenyl]piperazine-1-carboxylate (PubChem CID 86725376) has the molecular formula C29H33F2N3O2 and a molecular weight of 493.60 g/mol. Its IUPAC name is tert-butyl 4-[4-(dibenzylamino)-2,5-difluorophenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(dibenzylamino)-2,5-difluorophenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 86725376 |
| Molecular Formula | C29H33F2N3O2 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | tert-butyl 4-[4-(dibenzylamino)-2,5-difluorophenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cc(F)c(N(Cc3ccccc3)Cc3ccccc3)cc2F)CC1 |
| InChI | InChI=1S/C29H33F2N3O2/c1-29(2,3)36-28(35)33-16-14-32(15-17-33)26-18-25(31)27(19-24(26)30)34(20-22-10-6-4-7-11-22)21-23-12-8-5-9-13-23/h4-13,18-19H,14-17,20-21H2,1-3H3 |
| InChIKey | ZPOGROGGNYJBLL-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |