C30H37FN4O4 — CID 170041294
tert-butyl 4-[6-[bis[(4-methoxyphenyl)methyl]amino]-2-fluoro-3-pyridinyl]piperazine-1-carboxylate (PubChem CID 170041294) has the molecular formula C30H37FN4O4 and a molecular weight of 536.65 g/mol. Its IUPAC name is tert-butyl 4-[6-[bis[(4-methoxyphenyl)methyl]amino]-2-fluoro-3-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-[bis[(4-methoxyphenyl)methyl]amino]-2-fluoro-3-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170041294 |
| Molecular Formula | C30H37FN4O4 |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | tert-butyl 4-[6-[bis[(4-methoxyphenyl)methyl]amino]-2-fluoro-3-pyridinyl]piperazine-1-carboxylate |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)c(F)n2)cc1 |
| InChI | InChI=1S/C30H37FN4O4/c1-30(2,3)39-29(36)34-18-16-33(17-19-34)26-14-15-27(32-28(26)31)35(20-22-6-10-24(37-4)11-7-22)21-23-8-12-25(38-5)13-9-23/h6-15H,16-21H2,1-5H3 |
| InChIKey | VOUPDHHSDLAVJZ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 67.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|