C21H28N4O3S — CID 171811305
tert-butyl 4-[6-[(4-methoxyphenyl)methylsulfanyl]pyridazin-4-yl]piperazine-1-carboxylate (PubChem CID 171811305) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is tert-butyl 4-[6-[(4-methoxyphenyl)methylsulfanyl]pyridazin-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-[(4-methoxyphenyl)methylsulfanyl]pyridazin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171811305 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | tert-butyl 4-[6-[(4-methoxyphenyl)methylsulfanyl]pyridazin-4-yl]piperazine-1-carboxylate |
| SMILES | COc1ccc(CSc2cc(N3CCN(C(=O)OC(C)(C)C)CC3)cnn2)cc1 |
| InChI | InChI=1S/C21H28N4O3S/c1-21(2,3)28-20(26)25-11-9-24(10-12-25)17-13-19(23-22-14-17)29-15-16-5-7-18(27-4)8-6-16/h5-8,13-14H,9-12,15H2,1-4H3 |
| InChIKey | JFNHZWAHZMFLOP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |