C24H32N2O4 — CID 171985225
tert-butyl 4-[bis(4-methoxyphenyl)methyl]piperazine-1-carboxylate (PubChem CID 171985225) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is tert-butyl 4-[bis(4-methoxyphenyl)methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[bis(4-methoxyphenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171985225 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | tert-butyl 4-[bis(4-methoxyphenyl)methyl]piperazine-1-carboxylate |
| SMILES | COc1ccc(C(c2ccc(OC)cc2)N2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C24H32N2O4/c1-24(2,3)30-23(27)26-16-14-25(15-17-26)22(18-6-10-20(28-4)11-7-18)19-8-12-21(29-5)13-9-19/h6-13,22H,14-17H2,1-5H3 |
| InChIKey | CVNVAVZEULTZPX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |