C24H32N2O5S — CID 178027182
tert-butyl 4-[1-[4-(3-methoxyphenyl)sulfonylphenyl]ethyl]piperazine-1-carboxylate (PubChem CID 178027182) has the molecular formula C24H32N2O5S and a molecular weight of 460.60 g/mol. Its IUPAC name is tert-butyl 4-[1-[4-(3-methoxyphenyl)sulfonylphenyl]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[4-(3-methoxyphenyl)sulfonylphenyl]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 178027182 |
| Molecular Formula | C24H32N2O5S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | tert-butyl 4-[1-[4-(3-methoxyphenyl)sulfonylphenyl]ethyl]piperazine-1-carboxylate |
| SMILES | COc1cccc(S(=O)(=O)c2ccc(C(C)N3CCN(C(=O)OC(C)(C)C)CC3)cc2)c1 |
| InChI | InChI=1S/C24H32N2O5S/c1-18(25-13-15-26(16-14-25)23(27)31-24(2,3)4)19-9-11-21(12-10-19)32(28,29)22-8-6-7-20(17-22)30-5/h6-12,17-18H,13-16H2,1-5H3 |
| InChIKey | YICOCHZWFARMFW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |