C25H33ClN2O4 — CID 142599106
tert-butyl 4-[1-[4-(4-chlorophenyl)phenyl]ethyl]piperazine-1-carboxylate;methyl formate (PubChem CID 142599106) has the molecular formula C25H33ClN2O4 and a molecular weight of 461.00 g/mol. Its IUPAC name is tert-butyl 4-[1-[4-(4-chlorophenyl)phenyl]ethyl]piperazine-1-carboxylate;methyl formate.
| Compound Name | tert-butyl 4-[1-[4-(4-chlorophenyl)phenyl]ethyl]piperazine-1-carboxylate;methyl formate |
|---|---|
| PubChem CID | 142599106 |
| Molecular Formula | C25H33ClN2O4 |
| Molecular Weight | 461.00 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | tert-butyl 4-[1-[4-(4-chlorophenyl)phenyl]ethyl]piperazine-1-carboxylate;methyl formate |
| SMILES | CC(c1ccc(-c2ccc(Cl)cc2)cc1)N1CCN(C(=O)OC(C)(C)C)CC1.COC=O |
| InChI | InChI=1S/C23H29ClN2O2.C2H4O2/c1-17(25-13-15-26(16-14-25)22(27)28-23(2,3)4)18-5-7-19(8-6-18)20-9-11-21(24)12-10-20;1-4-2-3/h5-12,17H,13-16H2,1-4H3;2H,1H3 |
| InChIKey | NBFAHCFMXUAKBJ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.00 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|