C22H36ClN3O2 — CID 142156946
tert-butyl 4-[1-(4-chlorophenyl)-5-(dimethylamino)pentyl]piperazine-1-carboxylate (PubChem CID 142156946) has the molecular formula C22H36ClN3O2 and a molecular weight of 410.00 g/mol. Its IUPAC name is tert-butyl 4-[1-(4-chlorophenyl)-5-(dimethylamino)pentyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(4-chlorophenyl)-5-(dimethylamino)pentyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 142156946 |
| Molecular Formula | C22H36ClN3O2 |
| Molecular Weight | 410.00 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | tert-butyl 4-[1-(4-chlorophenyl)-5-(dimethylamino)pentyl]piperazine-1-carboxylate |
| SMILES | CN(C)CCCCC(c1ccc(Cl)cc1)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H36ClN3O2/c1-22(2,3)28-21(27)26-16-14-25(15-17-26)20(8-6-7-13-24(4)5)18-9-11-19(23)12-10-18/h9-12,20H,6-8,13-17H2,1-5H3 |
| InChIKey | LHKMJUMLGPXZNN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.00 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|