C20H27N3O2 — CID 142414052
tert-butyl 4-(1-quinolin-7-ylethyl)piperazine-1-carboxylate (PubChem CID 142414052) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is tert-butyl 4-(1-quinolin-7-ylethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(1-quinolin-7-ylethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 142414052 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | tert-butyl 4-(1-quinolin-7-ylethyl)piperazine-1-carboxylate |
| SMILES | CC(c1ccc2cccnc2c1)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H27N3O2/c1-15(17-8-7-16-6-5-9-21-18(16)14-17)22-10-12-23(13-11-22)19(24)25-20(2,3)4/h5-9,14-15H,10-13H2,1-4H3 |
| InChIKey | IVDBCJRJZGUQFK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |