C17H26N2O4 — CID 113077843
tert-butyl 4-(2,5-dimethoxyphenyl)piperazine-1-carboxylate (PubChem CID 113077843) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is tert-butyl 4-(2,5-dimethoxyphenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2,5-dimethoxyphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 113077843 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | tert-butyl 4-(2,5-dimethoxyphenyl)piperazine-1-carboxylate |
| SMILES | COc1ccc(OC)c(N2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C17H26N2O4/c1-17(2,3)23-16(20)19-10-8-18(9-11-19)14-12-13(21-4)6-7-15(14)22-5/h6-7,12H,8-11H2,1-5H3 |
| InChIKey | JEUNQUUVKXDHJP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |