C19H30N4O2 — CID 142622902
tert-butyl 4-(1-methylindazol-6-yl)piperazine-1-carboxylate;ethane (PubChem CID 142622902) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is tert-butyl 4-(1-methylindazol-6-yl)piperazine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-(1-methylindazol-6-yl)piperazine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 142622902 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | tert-butyl 4-(1-methylindazol-6-yl)piperazine-1-carboxylate;ethane |
| SMILES | CC.Cn1ncc2ccc(N3CCN(C(=O)OC(C)(C)C)CC3)cc21 |
| InChI | InChI=1S/C17H24N4O2.C2H6/c1-17(2,3)23-16(22)21-9-7-20(8-10-21)14-6-5-13-12-18-19(4)15(13)11-14;1-2/h5-6,11-12H,7-10H2,1-4H3;1-2H3 |
| InChIKey | HJEOKRKLNJKYBZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |