C24H30N4O3 — CID 59781293
tert-butyl 4-[1-[(4-methoxyphenyl)methyl]indazol-6-yl]piperazine-1-carboxylate (PubChem CID 59781293) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is tert-butyl 4-[1-[(4-methoxyphenyl)methyl]indazol-6-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[(4-methoxyphenyl)methyl]indazol-6-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59781293 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | tert-butyl 4-[1-[(4-methoxyphenyl)methyl]indazol-6-yl]piperazine-1-carboxylate |
| SMILES | COc1ccc(Cn2ncc3ccc(N4CCN(C(=O)OC(C)(C)C)CC4)cc32)cc1 |
| InChI | InChI=1S/C24H30N4O3/c1-24(2,3)31-23(29)27-13-11-26(12-14-27)20-8-7-19-16-25-28(22(19)15-20)17-18-5-9-21(30-4)10-6-18/h5-10,15-16H,11-14,17H2,1-4H3 |
| InChIKey | ROHAGHNKORQSQI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |