C21H29N5O5 — CID 86679987
tert-butyl (3S)-4-[1-[(4-methoxyphenyl)methyl]-4-nitropyrazol-5-yl]-3-methylpiperazine-1-carboxylate (PubChem CID 86679987) has the molecular formula C21H29N5O5 and a molecular weight of 431.49 g/mol. Its IUPAC name is tert-butyl (3S)-4-[1-[(4-methoxyphenyl)methyl]-4-nitropyrazol-5-yl]-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-[1-[(4-methoxyphenyl)methyl]-4-nitropyrazol-5-yl]-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 86679987 |
| Molecular Formula | C21H29N5O5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | tert-butyl (3S)-4-[1-[(4-methoxyphenyl)methyl]-4-nitropyrazol-5-yl]-3-methylpiperazine-1-carboxylate |
| SMILES | COc1ccc(Cn2ncc([N+](=O)[O-])c2N2CCN(C(=O)OC(C)(C)C)C[C@@H]2C)cc1 |
| InChI | InChI=1S/C21H29N5O5/c1-15-13-23(20(27)31-21(2,3)4)10-11-24(15)19-18(26(28)29)12-22-25(19)14-16-6-8-17(30-5)9-7-16/h6-9,12,15H,10-11,13-14H2,1-5H3/t15-/m0/s1 |
| InChIKey | QRIVLIAHRVQKKM-HNNXBMFYSA-N |
| XLogP | 3.29 |
| TPSA | 102.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|