C23H31N5O6 — CID 70874608
tert-butyl (3S)-3-methyl-4-[4-[[(7S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl]methoxy]phenyl]piperazine-1-carboxylate (PubChem CID 70874608) has the molecular formula C23H31N5O6 and a molecular weight of 473.53 g/mol. Its IUPAC name is tert-butyl (3S)-3-methyl-4-[4-[[(7S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl]methoxy]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-methyl-4-[4-[[(7S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl]methoxy]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 70874608 |
| Molecular Formula | C23H31N5O6 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | tert-butyl (3S)-3-methyl-4-[4-[[(7S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl]methoxy]phenyl]piperazine-1-carboxylate |
| SMILES | C[C@H]1CN(C(=O)OC(C)(C)C)CCN1c1ccc(OC[C@@H]2CCn3cc([N+](=O)[O-])nc3O2)cc1 |
| InChI | InChI=1S/C23H31N5O6/c1-16-13-26(22(29)34-23(2,3)4)11-12-27(16)17-5-7-18(8-6-17)32-15-19-9-10-25-14-20(28(30)31)24-21(25)33-19/h5-8,14,16,19H,9-13,15H2,1-4H3/t16-,19-/m0/s1 |
| InChIKey | KJOJQLPJMWLIRW-LPHOPBHVSA-N |
| XLogP | 3.47 |
| TPSA | 112.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|