C15H16N4O6 — CID 142725673
(2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl)methyl N-(4-methoxyphenyl)carbamate (PubChem CID 142725673) has the molecular formula C15H16N4O6 and a molecular weight of 348.32 g/mol. Its IUPAC name is (2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl)methyl N-(4-methoxyphenyl)carbamate.
| Compound Name | (2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl)methyl N-(4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 142725673 |
| Molecular Formula | C15H16N4O6 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl)methyl N-(4-methoxyphenyl)carbamate |
| SMILES | COc1ccc(NC(=O)OCC2CCn3cc([N+](=O)[O-])nc3O2)cc1 |
| InChI | InChI=1S/C15H16N4O6/c1-23-11-4-2-10(3-5-11)16-15(20)24-9-12-6-7-18-8-13(19(21)22)17-14(18)25-12/h2-5,8,12H,6-7,9H2,1H3,(H,16,20) |
| InChIKey | RUKJJEBLULSFPO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|