C7H8N4O5 — CID 89437400
(6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazol-2-yl)methyl carbamate (PubChem CID 89437400) has the molecular formula C7H8N4O5 and a molecular weight of 228.16 g/mol. Its IUPAC name is (6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazol-2-yl)methyl carbamate.
| Compound Name | (6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazol-2-yl)methyl carbamate |
|---|---|
| PubChem CID | 89437400 |
| Molecular Formula | C7H8N4O5 |
| Molecular Weight | 228.16 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | (6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazol-2-yl)methyl carbamate |
| SMILES | NC(=O)OCC1Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C7H8N4O5/c8-6(12)15-3-4-1-10-2-5(11(13)14)9-7(10)16-4/h2,4H,1,3H2,(H2,8,12) |
| InChIKey | AKHABRLRBUNSTB-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.16 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|