C16H16IN3O6 — CID 142731454
(4-iodophenyl)methyl 2-[(7R)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl]ethyl carbonate (PubChem CID 142731454) has the molecular formula C16H16IN3O6 and a molecular weight of 473.22 g/mol. Its IUPAC name is (4-iodophenyl)methyl 2-[(7R)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl]ethyl carbonate.
| Compound Name | (4-iodophenyl)methyl 2-[(7R)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl]ethyl carbonate |
|---|---|
| PubChem CID | 142731454 |
| Molecular Formula | C16H16IN3O6 |
| Molecular Weight | 473.22 g/mol |
| Exact Mass | 473.01 |
| IUPAC Name | (4-iodophenyl)methyl 2-[(7R)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl]ethyl carbonate |
| SMILES | O=C(OCC[C@H]1CCn2cc([N+](=O)[O-])nc2O1)OCc1ccc(I)cc1 |
| InChI | InChI=1S/C16H16IN3O6/c17-12-3-1-11(2-4-12)10-25-16(21)24-8-6-13-5-7-19-9-14(20(22)23)18-15(19)26-13/h1-4,9,13H,5-8,10H2/t13-/m1/s1 |
| InChIKey | BVIUMVSNUYLZCN-CYBMUJFWSA-N |
| XLogP | 3.29 |
| TPSA | 105.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.22 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|