C33H33F3N4O5 — CID 77141508
2-nitro-7-[[4-[4-[[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methyl]piperidin-1-yl]phenoxy]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (PubChem CID 77141508) has the molecular formula C33H33F3N4O5 and a molecular weight of 622.64 g/mol. Its IUPAC name is 2-nitro-7-[[4-[4-[[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methyl]piperidin-1-yl]phenoxy]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine.
| Compound Name | 2-nitro-7-[[4-[4-[[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methyl]piperidin-1-yl]phenoxy]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 77141508 |
| Molecular Formula | C33H33F3N4O5 |
| Molecular Weight | 622.64 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | 2-nitro-7-[[4-[4-[[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methyl]piperidin-1-yl]phenoxy]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC(COc1ccc(N3CCC(Cc4ccc(OCc5ccc(C(F)(F)F)cc5)cc4)CC3)cc1)CC2 |
| InChI | InChI=1S/C33H33F3N4O5/c34-33(35,36)26-5-1-25(2-6-26)21-43-28-9-3-23(4-10-28)19-24-13-16-38(17-14-24)27-7-11-29(12-8-27)44-22-30-15-18-39-20-31(40(41)42)37-32(39)45-30/h1-12,20,24,30H,13-19,21-22H2 |
| InChIKey | IYAIXCBJZYAJHO-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 91.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.64 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|