C28H33N5O6 — CID 70874289
tert-butyl 4-[4-[4-[(2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl)methoxy]phenyl]phenyl]piperazine-1-carboxylate (PubChem CID 70874289) has the molecular formula C28H33N5O6 and a molecular weight of 535.60 g/mol. Its IUPAC name is tert-butyl 4-[4-[4-[(2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl)methoxy]phenyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[4-[(2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl)methoxy]phenyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 70874289 |
| Molecular Formula | C28H33N5O6 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | tert-butyl 4-[4-[4-[(2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl)methoxy]phenyl]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(-c3ccc(OCC4CCn5cc([N+](=O)[O-])nc5O4)cc3)cc2)CC1 |
| InChI | InChI=1S/C28H33N5O6/c1-28(2,3)39-27(34)31-16-14-30(15-17-31)22-8-4-20(5-9-22)21-6-10-23(11-7-21)37-19-24-12-13-32-18-25(33(35)36)29-26(32)38-24/h4-11,18,24H,12-17,19H2,1-3H3 |
| InChIKey | LAQPGFITYMFUNB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 112.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|