C21H20F9N5O6S — CID 66558962
(7R)-2-nitro-7-[[4-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)piperazin-1-yl]phenoxy]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (PubChem CID 66558962) has the molecular formula C21H20F9N5O6S and a molecular weight of 641.47 g/mol. Its IUPAC name is (7R)-2-nitro-7-[[4-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)piperazin-1-yl]phenoxy]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine.
| Compound Name | (7R)-2-nitro-7-[[4-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)piperazin-1-yl]phenoxy]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 66558962 |
| Molecular Formula | C21H20F9N5O6S |
| Molecular Weight | 641.47 g/mol |
| Exact Mass | 641.10 |
| IUPAC Name | (7R)-2-nitro-7-[[4-[4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)piperazin-1-yl]phenoxy]methyl]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
| SMILES | O=[N+]([O-])c1cn2c(n1)O[C@@H](COc1ccc(N3CCN(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC3)cc1)CC2 |
| InChI | InChI=1S/C21H20F9N5O6S/c22-18(23,20(26,27)28)19(24,25)21(29,30)42(38,39)34-9-7-32(8-10-34)13-1-3-14(4-2-13)40-12-15-5-6-33-11-16(35(36)37)31-17(33)41-15/h1-4,11,15H,5-10,12H2/t15-/m1/s1 |
| InChIKey | ABZXDVHMBQXVJI-OAHLLOKOSA-N |
| XLogP | 3.90 |
| TPSA | 120.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|