C26H26F3N5O6 — CID 142725685
(2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl)methyl 4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazine-1-carboxylate (PubChem CID 142725685) has the molecular formula C26H26F3N5O6 and a molecular weight of 561.52 g/mol. Its IUPAC name is (2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl)methyl 4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazine-1-carboxylate.
| Compound Name | (2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl)methyl 4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 142725685 |
| Molecular Formula | C26H26F3N5O6 |
| Molecular Weight | 561.52 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | (2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-7-yl)methyl 4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazine-1-carboxylate |
| SMILES | O=C(OCC1CCn2cc([N+](=O)[O-])nc2O1)N1CCN(c2ccc(OCc3ccc(C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C26H26F3N5O6/c27-26(28,29)19-3-1-18(2-4-19)16-38-21-7-5-20(6-8-21)31-11-13-32(14-12-31)25(35)39-17-22-9-10-33-15-23(34(36)37)30-24(33)40-22/h1-8,15,22H,9-14,16-17H2 |
| InChIKey | NDXJYHQZCKFOGD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 112.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|