C18H17F3N4O5 — CID 23081329
[4-(trifluoromethyl)phenyl]methyl 6-nitrospiro[3H-imidazo[2,1-b][1,3]oxazole-2,4'-piperidine]-1'-carboxylate (PubChem CID 23081329) has the molecular formula C18H17F3N4O5 and a molecular weight of 426.35 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl]methyl 6-nitrospiro[3H-imidazo[2,1-b][1,3]oxazole-2,4'-piperidine]-1'-carboxylate.
| Compound Name | [4-(trifluoromethyl)phenyl]methyl 6-nitrospiro[3H-imidazo[2,1-b][1,3]oxazole-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 23081329 |
| Molecular Formula | C18H17F3N4O5 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | [4-(trifluoromethyl)phenyl]methyl 6-nitrospiro[3H-imidazo[2,1-b][1,3]oxazole-2,4'-piperidine]-1'-carboxylate |
| SMILES | O=C(OCc1ccc(C(F)(F)F)cc1)N1CCC2(CC1)Cn1cc([N+](=O)[O-])nc1O2 |
| InChI | InChI=1S/C18H17F3N4O5/c19-18(20,21)13-3-1-12(2-4-13)10-29-16(26)23-7-5-17(6-8-23)11-24-9-14(25(27)28)22-15(24)30-17/h1-4,9H,5-8,10-11H2 |
| InChIKey | KXWWEIMCSAXBMF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 99.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|