C15H14F3N3O5 — CID 50913481
2-methyl-6-nitro-2-[[4-(trifluoromethoxy)phenyl]methoxymethyl]-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 50913481) has the molecular formula C15H14F3N3O5 and a molecular weight of 373.29 g/mol. Its IUPAC name is 2-methyl-6-nitro-2-[[4-(trifluoromethoxy)phenyl]methoxymethyl]-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | 2-methyl-6-nitro-2-[[4-(trifluoromethoxy)phenyl]methoxymethyl]-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 50913481 |
| Molecular Formula | C15H14F3N3O5 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 2-methyl-6-nitro-2-[[4-(trifluoromethoxy)phenyl]methoxymethyl]-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | CC1(COCc2ccc(OC(F)(F)F)cc2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C15H14F3N3O5/c1-14(8-20-6-12(21(22)23)19-13(20)26-14)9-24-7-10-2-4-11(5-3-10)25-15(16,17)18/h2-6H,7-9H2,1H3 |
| InChIKey | GOANHVTUFFCYDW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 88.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|