C20H24F3N5O4 — CID 69480892
N-methyl-N-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]-1-[4-(trifluoromethoxy)phenyl]piperidin-4-amine (PubChem CID 69480892) has the molecular formula C20H24F3N5O4 and a molecular weight of 455.44 g/mol. Its IUPAC name is N-methyl-N-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]-1-[4-(trifluoromethoxy)phenyl]piperidin-4-amine.
| Compound Name | N-methyl-N-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]-1-[4-(trifluoromethoxy)phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 69480892 |
| Molecular Formula | C20H24F3N5O4 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | N-methyl-N-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methyl]-1-[4-(trifluoromethoxy)phenyl]piperidin-4-amine |
| SMILES | CN(C[C@@]1(C)Cn2cc([N+](=O)[O-])nc2O1)C1CCN(c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H24F3N5O4/c1-19(13-27-11-17(28(29)30)24-18(27)32-19)12-25(2)14-7-9-26(10-8-14)15-3-5-16(6-4-15)31-20(21,22)23/h3-6,11,14H,7-10,12-13H2,1-2H3/t19-/m0/s1 |
| InChIKey | RNXQBURUSKEQKC-IBGZPJMESA-N |
| XLogP | 3.44 |
| TPSA | 85.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|