C19H15F3N4O5 — CID 50913333
2-methyl-6-nitro-2-[[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]oxymethyl]-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 50913333) has the molecular formula C19H15F3N4O5 and a molecular weight of 436.35 g/mol. Its IUPAC name is 2-methyl-6-nitro-2-[[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]oxymethyl]-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | 2-methyl-6-nitro-2-[[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]oxymethyl]-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 50913333 |
| Molecular Formula | C19H15F3N4O5 |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 2-methyl-6-nitro-2-[[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]oxymethyl]-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | CC1(COc2ccc(-c3ccc(OC(F)(F)F)cc3)cn2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C19H15F3N4O5/c1-18(10-25-9-15(26(27)28)24-17(25)31-18)11-29-16-7-4-13(8-23-16)12-2-5-14(6-3-12)30-19(20,21)22/h2-9H,10-11H2,1H3 |
| InChIKey | VGWKSCHHKMKBGM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 101.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|