C28H31F3N4O7 — CID 53469646
(2R)-2-methyl-6-nitro-2-[[4-[[4-[2-[4-(trifluoromethoxy)phenoxy]ethoxy]piperidin-1-yl]methyl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 53469646) has the molecular formula C28H31F3N4O7 and a molecular weight of 592.57 g/mol. Its IUPAC name is (2R)-2-methyl-6-nitro-2-[[4-[[4-[2-[4-(trifluoromethoxy)phenoxy]ethoxy]piperidin-1-yl]methyl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | (2R)-2-methyl-6-nitro-2-[[4-[[4-[2-[4-(trifluoromethoxy)phenoxy]ethoxy]piperidin-1-yl]methyl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 53469646 |
| Molecular Formula | C28H31F3N4O7 |
| Molecular Weight | 592.57 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | (2R)-2-methyl-6-nitro-2-[[4-[[4-[2-[4-(trifluoromethoxy)phenoxy]ethoxy]piperidin-1-yl]methyl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | C[C@]1(COc2ccc(CN3CCC(OCCOc4ccc(OC(F)(F)F)cc4)CC3)cc2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C28H31F3N4O7/c1-27(18-34-17-25(35(36)37)32-26(34)42-27)19-40-22-4-2-20(3-5-22)16-33-12-10-23(11-13-33)39-15-14-38-21-6-8-24(9-7-21)41-28(29,30)31/h2-9,17,23H,10-16,18-19H2,1H3/t27-/m1/s1 |
| InChIKey | BYZICAQULSLJES-HHHXNRCGSA-N |
| XLogP | 4.98 |
| TPSA | 110.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|