C27H26F3N5O6 — CID 5278883
(2R)-2-methyl-6-nitro-2-[[4-[4-[[5-(trifluoromethoxy)-1-benzofuran-2-yl]methyl]piperazin-1-yl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 5278883) has the molecular formula C27H26F3N5O6 and a molecular weight of 573.53 g/mol. Its IUPAC name is (2R)-2-methyl-6-nitro-2-[[4-[4-[[5-(trifluoromethoxy)-1-benzofuran-2-yl]methyl]piperazin-1-yl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | (2R)-2-methyl-6-nitro-2-[[4-[4-[[5-(trifluoromethoxy)-1-benzofuran-2-yl]methyl]piperazin-1-yl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 5278883 |
| Molecular Formula | C27H26F3N5O6 |
| Molecular Weight | 573.53 g/mol |
| Exact Mass | 573.18 |
| IUPAC Name | (2R)-2-methyl-6-nitro-2-[[4-[4-[[5-(trifluoromethoxy)-1-benzofuran-2-yl]methyl]piperazin-1-yl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | C[C@]1(COc2ccc(N3CCN(Cc4cc5cc(OC(F)(F)F)ccc5o4)CC3)cc2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C27H26F3N5O6/c1-26(16-34-15-24(35(36)37)31-25(34)41-26)17-38-20-4-2-19(3-5-20)33-10-8-32(9-11-33)14-22-13-18-12-21(40-27(28,29)30)6-7-23(18)39-22/h2-7,12-13,15H,8-11,14,16-17H2,1H3/t26-/m1/s1 |
| InChIKey | ANIXTCARKZJKBH-AREMUKBSSA-N |
| XLogP | 4.99 |
| TPSA | 108.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|