C27H27ClN4O5 — CID 142756664
(2R)-2-[[4-[4-[(5-chloro-1-benzofuran-2-yl)methyl]piperidin-1-yl]phenoxy]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 142756664) has the molecular formula C27H27ClN4O5 and a molecular weight of 522.99 g/mol. Its IUPAC name is (2R)-2-[[4-[4-[(5-chloro-1-benzofuran-2-yl)methyl]piperidin-1-yl]phenoxy]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | (2R)-2-[[4-[4-[(5-chloro-1-benzofuran-2-yl)methyl]piperidin-1-yl]phenoxy]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 142756664 |
| Molecular Formula | C27H27ClN4O5 |
| Molecular Weight | 522.99 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | (2R)-2-[[4-[4-[(5-chloro-1-benzofuran-2-yl)methyl]piperidin-1-yl]phenoxy]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | C[C@]1(COc2ccc(N3CCC(Cc4cc5cc(Cl)ccc5o4)CC3)cc2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C27H27ClN4O5/c1-27(16-31-15-25(32(33)34)29-26(31)37-27)17-35-22-5-3-21(4-6-22)30-10-8-18(9-11-30)12-23-14-19-13-20(28)2-7-24(19)36-23/h2-7,13-15,18H,8-12,16-17H2,1H3/t27-/m1/s1 |
| InChIKey | LKQMGHAGFABUMG-HHHXNRCGSA-N |
| XLogP | 5.88 |
| TPSA | 95.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.99 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|