C25H25ClF3N5O4 — CID 5278859
N-[2-chloro-4-(trifluoromethyl)phenyl]-1-[4-[[(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]piperidin-4-amine (PubChem CID 5278859) has the molecular formula C25H25ClF3N5O4 and a molecular weight of 551.95 g/mol. Its IUPAC name is N-[2-chloro-4-(trifluoromethyl)phenyl]-1-[4-[[(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]piperidin-4-amine.
| Compound Name | N-[2-chloro-4-(trifluoromethyl)phenyl]-1-[4-[[(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 5278859 |
| Molecular Formula | C25H25ClF3N5O4 |
| Molecular Weight | 551.95 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | N-[2-chloro-4-(trifluoromethyl)phenyl]-1-[4-[[(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]piperidin-4-amine |
| SMILES | C[C@]1(COc2ccc(N3CCC(Nc4ccc(C(F)(F)F)cc4Cl)CC3)cc2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C25H25ClF3N5O4/c1-24(14-33-13-22(34(35)36)31-23(33)38-24)15-37-19-5-3-18(4-6-19)32-10-8-17(9-11-32)30-21-7-2-16(12-20(21)26)25(27,28)29/h2-7,12-13,17,30H,8-11,14-15H2,1H3/t24-/m1/s1 |
| InChIKey | LEAOSIKRYXABLS-XMMPIXPASA-N |
| XLogP | 5.77 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.95 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|