C17H20N4O5S — CID 6483576
4-[4-[[(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]-1,4-thiazinane 1-oxide (PubChem CID 6483576) has the molecular formula C17H20N4O5S and a molecular weight of 392.44 g/mol. Its IUPAC name is 4-[4-[[(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]-1,4-thiazinane 1-oxide.
| Compound Name | 4-[4-[[(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 6483576 |
| Molecular Formula | C17H20N4O5S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 4-[4-[[(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]-1,4-thiazinane 1-oxide |
| SMILES | C[C@]1(COc2ccc(N3CCS(=O)CC3)cc2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C17H20N4O5S/c1-17(11-20-10-15(21(22)23)18-16(20)26-17)12-25-14-4-2-13(3-5-14)19-6-8-27(24)9-7-19/h2-5,10H,6-9,11-12H2,1H3/t17-/m1/s1 |
| InChIKey | VKZSAWATCYUSJG-QGZVFWFLSA-N |
| XLogP | 1.59 |
| TPSA | 99.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|