C24H32N4O6 — CID 67274591
2-methyl-6-nitro-2-[[4-[4-[[(2R)-oxan-2-yl]oxymethyl]piperidin-1-yl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 67274591) has the molecular formula C24H32N4O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is 2-methyl-6-nitro-2-[[4-[4-[[(2R)-oxan-2-yl]oxymethyl]piperidin-1-yl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | 2-methyl-6-nitro-2-[[4-[4-[[(2R)-oxan-2-yl]oxymethyl]piperidin-1-yl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 67274591 |
| Molecular Formula | C24H32N4O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 2-methyl-6-nitro-2-[[4-[4-[[(2R)-oxan-2-yl]oxymethyl]piperidin-1-yl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | CC1(COc2ccc(N3CCC(CO[C@@H]4CCCCO4)CC3)cc2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C24H32N4O6/c1-24(16-27-14-21(28(29)30)25-23(27)34-24)17-33-20-7-5-19(6-8-20)26-11-9-18(10-12-26)15-32-22-4-2-3-13-31-22/h5-8,14,18,22H,2-4,9-13,15-17H2,1H3/t22-,24?/m1/s1 |
| InChIKey | HAYBWUWQMZZANA-LETIRJCYSA-N |
| XLogP | 3.78 |
| TPSA | 101.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|