C25H26Cl2N4O4 — CID 66887503
2-[[4-[4-[(3,4-dichlorophenyl)methyl]piperidin-1-yl]phenoxy]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 66887503) has the molecular formula C25H26Cl2N4O4 and a molecular weight of 517.41 g/mol. Its IUPAC name is 2-[[4-[4-[(3,4-dichlorophenyl)methyl]piperidin-1-yl]phenoxy]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | 2-[[4-[4-[(3,4-dichlorophenyl)methyl]piperidin-1-yl]phenoxy]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 66887503 |
| Molecular Formula | C25H26Cl2N4O4 |
| Molecular Weight | 517.41 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | 2-[[4-[4-[(3,4-dichlorophenyl)methyl]piperidin-1-yl]phenoxy]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | CC1(COc2ccc(N3CCC(Cc4ccc(Cl)c(Cl)c4)CC3)cc2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C25H26Cl2N4O4/c1-25(15-30-14-23(31(32)33)28-24(30)35-25)16-34-20-5-3-19(4-6-20)29-10-8-17(9-11-29)12-18-2-7-21(26)22(27)13-18/h2-7,13-14,17H,8-12,15-16H2,1H3 |
| InChIKey | QKWWRWDPEKUFQM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 82.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.41 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|