C25H25Cl2N5O6 — CID 10008004
(3,4-dichlorophenyl)methyl 4-[4-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]piperazine-1-carboxylate (PubChem CID 10008004) has the molecular formula C25H25Cl2N5O6 and a molecular weight of 562.41 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl 4-[4-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]piperazine-1-carboxylate.
| Compound Name | (3,4-dichlorophenyl)methyl 4-[4-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 10008004 |
| Molecular Formula | C25H25Cl2N5O6 |
| Molecular Weight | 562.41 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | (3,4-dichlorophenyl)methyl 4-[4-[[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]piperazine-1-carboxylate |
| SMILES | C[C@@]1(COc2ccc(N3CCN(C(=O)OCc4ccc(Cl)c(Cl)c4)CC3)cc2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C25H25Cl2N5O6/c1-25(15-31-13-22(32(34)35)28-23(31)38-25)16-37-19-5-3-18(4-6-19)29-8-10-30(11-9-29)24(33)36-14-17-2-7-20(26)21(27)12-17/h2-7,12-13H,8-11,14-16H2,1H3/t25-/m0/s1 |
| InChIKey | KLYOKTHRMAYFJG-VWLOTQADSA-N |
| XLogP | 4.79 |
| TPSA | 112.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|