C29H33F3N6O4 — CID 11365299
(2S)-2-methyl-6-nitro-2-[[4-[4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 11365299) has the molecular formula C29H33F3N6O4 and a molecular weight of 586.62 g/mol. Its IUPAC name is (2S)-2-methyl-6-nitro-2-[[4-[4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | (2S)-2-methyl-6-nitro-2-[[4-[4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 11365299 |
| Molecular Formula | C29H33F3N6O4 |
| Molecular Weight | 586.62 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | (2S)-2-methyl-6-nitro-2-[[4-[4-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | C[C@@]1(COc2ccc(N3CCC(N4CCN(c5ccc(C(F)(F)F)cc5)CC4)CC3)cc2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C29H33F3N6O4/c1-28(19-37-18-26(38(39)40)33-27(37)42-28)20-41-25-8-6-23(7-9-25)34-12-10-24(11-13-34)36-16-14-35(15-17-36)22-4-2-21(3-5-22)29(30,31)32/h2-9,18,24H,10-17,19-20H2,1H3/t28-/m0/s1 |
| InChIKey | GQGDMEWTNSNKDE-NDEPHWFRSA-N |
| XLogP | 4.83 |
| TPSA | 89.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.62 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|