C27H28F3N5O4 — CID 11421386
(2R)-2-methyl-6-nitro-2-[[4-[4-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enyl]piperazin-1-yl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 11421386) has the molecular formula C27H28F3N5O4 and a molecular weight of 543.55 g/mol. Its IUPAC name is (2R)-2-methyl-6-nitro-2-[[4-[4-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enyl]piperazin-1-yl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | (2R)-2-methyl-6-nitro-2-[[4-[4-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enyl]piperazin-1-yl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 11421386 |
| Molecular Formula | C27H28F3N5O4 |
| Molecular Weight | 543.55 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | (2R)-2-methyl-6-nitro-2-[[4-[4-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enyl]piperazin-1-yl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | C[C@]1(COc2ccc(N3CCN(C/C=C/c4ccc(C(F)(F)F)cc4)CC3)cc2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C27H28F3N5O4/c1-26(18-34-17-24(35(36)37)31-25(34)39-26)19-38-23-10-8-22(9-11-23)33-15-13-32(14-16-33)12-2-3-20-4-6-21(7-5-20)27(28,29)30/h2-11,17H,12-16,18-19H2,1H3/b3-2+/t26-/m1/s1 |
| InChIKey | VUKHQGOCWIHKJU-DXPVHIICSA-N |
| XLogP | 4.88 |
| TPSA | 85.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|