C25H28ClN5O4 — CID 67274245
N-(4-chlorophenyl)-N-methyl-1-[4-[[(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]piperidin-4-amine (PubChem CID 67274245) has the molecular formula C25H28ClN5O4 and a molecular weight of 497.98 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N-methyl-1-[4-[[(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]piperidin-4-amine.
| Compound Name | N-(4-chlorophenyl)-N-methyl-1-[4-[[(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 67274245 |
| Molecular Formula | C25H28ClN5O4 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | N-(4-chlorophenyl)-N-methyl-1-[4-[[(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]piperidin-4-amine |
| SMILES | CN(c1ccc(Cl)cc1)C1CCN(c2ccc(OC[C@@]3(C)Cn4cc([N+](=O)[O-])nc4O3)cc2)CC1 |
| InChI | InChI=1S/C25H28ClN5O4/c1-25(16-30-15-23(31(32)33)27-24(30)35-25)17-34-22-9-7-21(8-10-22)29-13-11-20(12-14-29)28(2)19-5-3-18(26)4-6-19/h3-10,15,20H,11-14,16-17H2,1-2H3/t25-/m1/s1 |
| InChIKey | ZDVVXVUUPMEDAT-RUZDIDTESA-N |
| XLogP | 4.78 |
| TPSA | 85.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|