C18H20ClN5O6 — CID 69481197
4-[2-chloro-4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methoxy]phenyl]piperazine-1-carboxylic acid (PubChem CID 69481197) has the molecular formula C18H20ClN5O6 and a molecular weight of 437.84 g/mol. Its IUPAC name is 4-[2-chloro-4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methoxy]phenyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[2-chloro-4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methoxy]phenyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 69481197 |
| Molecular Formula | C18H20ClN5O6 |
| Molecular Weight | 437.84 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 4-[2-chloro-4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methoxy]phenyl]piperazine-1-carboxylic acid |
| SMILES | CC1(COc2ccc(N3CCN(C(=O)O)CC3)c(Cl)c2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C18H20ClN5O6/c1-18(10-23-9-15(24(27)28)20-16(23)30-18)11-29-12-2-3-14(13(19)8-12)21-4-6-22(7-5-21)17(25)26/h2-3,8-9H,4-7,10-11H2,1H3,(H,25,26) |
| InChIKey | AJTIYAPLJDVWFD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 123.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.84 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|