C20H25N5O8S — CID 122484664
2-ethyl-4-[4-[[(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]sulfonylpiperazine-1-carboxylic acid (PubChem CID 122484664) has the molecular formula C20H25N5O8S and a molecular weight of 495.51 g/mol. Its IUPAC name is 2-ethyl-4-[4-[[(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]sulfonylpiperazine-1-carboxylic acid.
| Compound Name | 2-ethyl-4-[4-[[(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]sulfonylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 122484664 |
| Molecular Formula | C20H25N5O8S |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 2-ethyl-4-[4-[[(2R)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methoxy]phenyl]sulfonylpiperazine-1-carboxylic acid |
| SMILES | CCC1CN(S(=O)(=O)c2ccc(OC[C@@]3(C)Cn4cc([N+](=O)[O-])nc4O3)cc2)CCN1C(=O)O |
| InChI | InChI=1S/C20H25N5O8S/c1-3-14-10-23(8-9-24(14)19(26)27)34(30,31)16-6-4-15(5-7-16)32-13-20(2)12-22-11-17(25(28)29)21-18(22)33-20/h4-7,11,14H,3,8-10,12-13H2,1-2H3,(H,26,27)/t14?,20-/m1/s1 |
| InChIKey | OLWWCFLGVNINAF-YBMSBYLISA-N |
| XLogP | 1.78 |
| TPSA | 157.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|